C15H22FNO3 — CID 65108883
1-[[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]methyl]cyclopentan-1-ol (PubChem CID 65108883) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is 1-[[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65108883 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-[[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]methyl]cyclopentan-1-ol |
| SMILES | OC(CNCC1(O)CCCC1)COc1ccccc1F |
| InChI | InChI=1S/C15H22FNO3/c16-13-5-1-2-6-14(13)20-10-12(18)9-17-11-15(19)7-3-4-8-15/h1-2,5-6,12,17-19H,3-4,7-11H2 |
| InChIKey | MZTMCSCUYRCXAP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |