C12H21N5O2 — CID 65123925
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 65123925) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 65123925 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | CCC1CCC(O)(CNC(=O)Cn2cnnn2)CC1 |
| InChI | InChI=1S/C12H21N5O2/c1-2-10-3-5-12(19,6-4-10)8-13-11(18)7-17-9-14-15-16-17/h9-10,19H,2-8H2,1H3,(H,13,18) |
| InChIKey | STUYPVWKCUSYKG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |