About (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate
(3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate (PubChem CID 65127067) has the molecular formula C11H10ClN3O2
and a molecular weight of 251.67 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate |
| PubChem CID | 65127067 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate |
| SMILES | Nc1cc(C(=O)OCc2cccc(Cl)c2)[nH]n1 |
| InChI | InChI=1S/C11H10ClN3O2/c12-8-3-1-2-7(4-8)6-17-11(16)9-5-10(13)15-14-9/h1-5H,6H2,(H3,13,14,15) |
| InChIKey | HHUCEHPKPZBASK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate?
The IUPAC name of (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate (CID 65127067) is (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate.
What is the SMILES notation for (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate?
The canonical SMILES for (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate is Nc1cc(C(=O)OCc2cccc(Cl)c2)[nH]n1.
What is the InChIKey of (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate?
The InChIKey is HHUCEHPKPZBASK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O2/c12-8-3-1-2-7(4-8)6-17-11(16)9-5-10(13)15-14-9/h1-5H,6H2,(H3,13,14,15).
What are the key properties of (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate?
(3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate has a molecular weight of 251.67 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl 3-amino-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 65127067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).