C15H16ClN3O2 — CID 65127477
(3-chlorophenyl)methyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate (PubChem CID 65127477) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 65127477 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3-chlorophenyl)methyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate |
| SMILES | NC1(c2ncc(C(=O)OCc3cccc(Cl)c3)[nH]2)CCC1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-11-4-1-3-10(7-11)9-21-13(20)12-8-18-14(19-12)15(17)5-2-6-15/h1,3-4,7-8H,2,5-6,9,17H2,(H,18,19) |
| InChIKey | QTCKNBMQZSLUSL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |