C12H27NS — CID 65129203
N,4-dimethyl-1-propylsulfanylheptan-2-amine (PubChem CID 65129203) has the molecular formula C12H27NS and a molecular weight of 217.42 g/mol. Its IUPAC name is N,4-dimethyl-1-propylsulfanylheptan-2-amine.
| Compound Name | N,4-dimethyl-1-propylsulfanylheptan-2-amine |
|---|---|
| PubChem CID | 65129203 |
| Molecular Formula | C12H27NS |
| Molecular Weight | 217.42 g/mol |
| Exact Mass | 217.19 |
| IUPAC Name | N,4-dimethyl-1-propylsulfanylheptan-2-amine |
| SMILES | CCCSCC(CC(C)CCC)NC |
| InChI | InChI=1S/C12H27NS/c1-5-7-11(3)9-12(13-4)10-14-8-6-2/h11-13H,5-10H2,1-4H3 |
| InChIKey | LCUHBXSLWFHMSF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|