C13H19Cl2NS — CID 65133097
1-tert-butylsulfanyl-3-(2,6-dichlorophenyl)propan-2-amine (PubChem CID 65133097) has the molecular formula C13H19Cl2NS and a molecular weight of 292.27 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-3-(2,6-dichlorophenyl)propan-2-amine.
| Compound Name | 1-tert-butylsulfanyl-3-(2,6-dichlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 65133097 |
| Molecular Formula | C13H19Cl2NS |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-tert-butylsulfanyl-3-(2,6-dichlorophenyl)propan-2-amine |
| SMILES | CC(C)(C)SCC(N)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H19Cl2NS/c1-13(2,3)17-8-9(16)7-10-11(14)5-4-6-12(10)15/h4-6,9H,7-8,16H2,1-3H3 |
| InChIKey | CEFZYPXGSSWLLD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |