C10H13F3N2O2S — CID 65134650
1,1,1-trifluoro-3-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 65134650) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 1,1,1-trifluoro-3-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 65134650 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CCCSCc1noc(C(C)C(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O2S/c1-3-4-18-5-7-14-9(17-15-7)6(2)8(16)10(11,12)13/h6H,3-5H2,1-2H3 |
| InChIKey | RKJMXQVVOQSHND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|