C16H20O2S — CID 65142377
2-phenylsulfanylspiro[3.5]nonane-2-carboxylic acid (PubChem CID 65142377) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-phenylsulfanylspiro[3.5]nonane-2-carboxylic acid.
| Compound Name | 2-phenylsulfanylspiro[3.5]nonane-2-carboxylic acid |
|---|---|
| PubChem CID | 65142377 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-phenylsulfanylspiro[3.5]nonane-2-carboxylic acid |
| SMILES | O=C(O)C1(Sc2ccccc2)CC2(CCCCC2)C1 |
| InChI | InChI=1S/C16H20O2S/c17-14(18)16(19-13-7-3-1-4-8-13)11-15(12-16)9-5-2-6-10-15/h1,3-4,7-8H,2,5-6,9-12H2,(H,17,18) |
| InChIKey | QXEBTIUNYYNECB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |