C17H22O2S — CID 66112160
2-(3-methylphenyl)sulfanylspiro[3.5]nonane-2-carboxylic acid (PubChem CID 66112160) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-(3-methylphenyl)sulfanylspiro[3.5]nonane-2-carboxylic acid.
| Compound Name | 2-(3-methylphenyl)sulfanylspiro[3.5]nonane-2-carboxylic acid |
|---|---|
| PubChem CID | 66112160 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(3-methylphenyl)sulfanylspiro[3.5]nonane-2-carboxylic acid |
| SMILES | Cc1cccc(SC2(C(=O)O)CC3(CCCCC3)C2)c1 |
| InChI | InChI=1S/C17H22O2S/c1-13-6-5-7-14(10-13)20-17(15(18)19)11-16(12-17)8-3-2-4-9-16/h5-7,10H,2-4,8-9,11-12H2,1H3,(H,18,19) |
| InChIKey | YMAXKCBFDZMDTP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |