C14H19NS — CID 66110003
[5-(3-methylphenyl)sulfanylspiro[2.3]hexan-5-yl]methanamine (PubChem CID 66110003) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is [5-(3-methylphenyl)sulfanylspiro[2.3]hexan-5-yl]methanamine.
| Compound Name | [5-(3-methylphenyl)sulfanylspiro[2.3]hexan-5-yl]methanamine |
|---|---|
| PubChem CID | 66110003 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | [5-(3-methylphenyl)sulfanylspiro[2.3]hexan-5-yl]methanamine |
| SMILES | Cc1cccc(SC2(CN)CC3(CC3)C2)c1 |
| InChI | InChI=1S/C14H19NS/c1-11-3-2-4-12(7-11)16-14(10-15)8-13(9-14)5-6-13/h2-4,7H,5-6,8-10,15H2,1H3 |
| InChIKey | IMTNVBFWROEWRC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |