C17H24FNS — CID 66096585
[2-(2-fluorophenyl)sulfanylspiro[3.6]decan-2-yl]methanamine (PubChem CID 66096585) has the molecular formula C17H24FNS and a molecular weight of 293.45 g/mol. Its IUPAC name is [2-(2-fluorophenyl)sulfanylspiro[3.6]decan-2-yl]methanamine.
| Compound Name | [2-(2-fluorophenyl)sulfanylspiro[3.6]decan-2-yl]methanamine |
|---|---|
| PubChem CID | 66096585 |
| Molecular Formula | C17H24FNS |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [2-(2-fluorophenyl)sulfanylspiro[3.6]decan-2-yl]methanamine |
| SMILES | NCC1(Sc2ccccc2F)CC2(CCCCCC2)C1 |
| InChI | InChI=1S/C17H24FNS/c18-14-7-3-4-8-15(14)20-17(13-19)11-16(12-17)9-5-1-2-6-10-16/h3-4,7-8H,1-2,5-6,9-13,19H2 |
| InChIKey | VAAKTFYTDVUKEW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |