C11H14FNOS — CID 82984157
[2-(aminomethyl)-2-(2-fluorophenyl)sulfanylcyclopropyl]methanol (PubChem CID 82984157) has the molecular formula C11H14FNOS and a molecular weight of 227.30 g/mol. Its IUPAC name is [2-(aminomethyl)-2-(2-fluorophenyl)sulfanylcyclopropyl]methanol.
| Compound Name | [2-(aminomethyl)-2-(2-fluorophenyl)sulfanylcyclopropyl]methanol |
|---|---|
| PubChem CID | 82984157 |
| Molecular Formula | C11H14FNOS |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [2-(aminomethyl)-2-(2-fluorophenyl)sulfanylcyclopropyl]methanol |
| SMILES | NCC1(Sc2ccccc2F)CC1CO |
| InChI | InChI=1S/C11H14FNOS/c12-9-3-1-2-4-10(9)15-11(7-13)5-8(11)6-14/h1-4,8,14H,5-7,13H2 |
| InChIKey | MBNPQZNEBAVIQP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |