C18H23NO4S — CID 119251216
4-hydroxy-1-(1-phenylsulfanylcyclopentanecarbonyl)piperidine-4-carboxylic acid (PubChem CID 119251216) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 4-hydroxy-1-(1-phenylsulfanylcyclopentanecarbonyl)piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-(1-phenylsulfanylcyclopentanecarbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251216 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-hydroxy-1-(1-phenylsulfanylcyclopentanecarbonyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(O)CCN(C(=O)C2(Sc3ccccc3)CCCC2)CC1 |
| InChI | InChI=1S/C18H23NO4S/c20-15(19-12-10-17(23,11-13-19)16(21)22)18(8-4-5-9-18)24-14-6-2-1-3-7-14/h1-3,6-7,23H,4-5,8-13H2,(H,21,22) |
| InChIKey | HHBPTNYCIQWEOT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |