C16H26OS — CID 65142694
5-methyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)cyclohexan-1-ol (PubChem CID 65142694) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)cyclohexan-1-ol.
| Compound Name | 5-methyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 65142694 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 5-methyl-2-propan-2-yl-1-(2-thiophen-3-ylethyl)cyclohexan-1-ol |
| SMILES | CC1CCC(C(C)C)C(O)(CCc2ccsc2)C1 |
| InChI | InChI=1S/C16H26OS/c1-12(2)15-5-4-13(3)10-16(15,17)8-6-14-7-9-18-11-14/h7,9,11-13,15,17H,4-6,8,10H2,1-3H3 |
| InChIKey | AXCIHDGJLWQTLM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |