C25H23N3O7S — CID 6514490
N-[(Z)-3-[(1,1-dioxothiolan-3-yl)amino]-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 6514490) has the molecular formula C25H23N3O7S and a molecular weight of 509.54 g/mol. Its IUPAC name is N-[(Z)-3-[(1,1-dioxothiolan-3-yl)amino]-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[(Z)-3-[(1,1-dioxothiolan-3-yl)amino]-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 6514490 |
| Molecular Formula | C25H23N3O7S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | N-[(Z)-3-[(1,1-dioxothiolan-3-yl)amino]-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2ccc(-c3ccccc3[N+](=O)[O-])o2)C(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C25H23N3O7S/c1-16-6-8-17(9-7-16)24(29)27-21(25(30)26-18-12-13-36(33,34)15-18)14-19-10-11-23(35-19)20-4-2-3-5-22(20)28(31)32/h2-11,14,18H,12-13,15H2,1H3,(H,26,30)(H,27,29)/b21-14- |
| InChIKey | IBEYLUCXLGTZPC-STZFKDTASA-N |
| XLogP | 3.24 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|