C13H10BrF3O2S — CID 65148260
2-(4-bromothiophen-2-yl)-1-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 65148260) has the molecular formula C13H10BrF3O2S and a molecular weight of 367.19 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-[4-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-[4-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 65148260 |
| Molecular Formula | C13H10BrF3O2S |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | OC(Cc1cc(Br)cs1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10BrF3O2S/c14-9-5-11(20-7-9)6-12(18)8-1-3-10(4-2-8)19-13(15,16)17/h1-5,7,12,18H,6H2 |
| InChIKey | JVRDWXANJZFDMM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |