C12H24O3S — CID 65149018
3,3-dimethyl-1-(3-methylsulfonylpropyl)cyclohexan-1-ol (PubChem CID 65149018) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-methylsulfonylpropyl)cyclohexan-1-ol.
| Compound Name | 3,3-dimethyl-1-(3-methylsulfonylpropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 65149018 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3,3-dimethyl-1-(3-methylsulfonylpropyl)cyclohexan-1-ol |
| SMILES | CC1(C)CCCC(O)(CCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H24O3S/c1-11(2)6-4-7-12(13,10-11)8-5-9-16(3,14)15/h13H,4-10H2,1-3H3 |
| InChIKey | OPBFYQCGGMAKIE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |