C16H15ClOS — CID 65152089
3-[1-benzothiophen-3-yl(chloro)methyl]-2,4,5-trimethylfuran (PubChem CID 65152089) has the molecular formula C16H15ClOS and a molecular weight of 290.81 g/mol. Its IUPAC name is 3-[1-benzothiophen-3-yl(chloro)methyl]-2,4,5-trimethylfuran.
| Compound Name | 3-[1-benzothiophen-3-yl(chloro)methyl]-2,4,5-trimethylfuran |
|---|---|
| PubChem CID | 65152089 |
| Molecular Formula | C16H15ClOS |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-[1-benzothiophen-3-yl(chloro)methyl]-2,4,5-trimethylfuran |
| SMILES | Cc1oc(C)c(C(Cl)c2csc3ccccc23)c1C |
| InChI | InChI=1S/C16H15ClOS/c1-9-10(2)18-11(3)15(9)16(17)13-8-19-14-7-5-4-6-12(13)14/h4-8,16H,1-3H3 |
| InChIKey | BCMBIZDWBDJRRE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|