C11H19N3O — CID 65152644
N-amino-2,4,5-trimethyl-N'-propan-2-ylfuran-3-carboximidamide (PubChem CID 65152644) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-amino-2,4,5-trimethyl-N'-propan-2-ylfuran-3-carboximidamide.
| Compound Name | N-amino-2,4,5-trimethyl-N'-propan-2-ylfuran-3-carboximidamide |
|---|---|
| PubChem CID | 65152644 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-amino-2,4,5-trimethyl-N'-propan-2-ylfuran-3-carboximidamide |
| SMILES | Cc1oc(C)c(/C(=N/C(C)C)NN)c1C |
| InChI | InChI=1S/C11H19N3O/c1-6(2)13-11(14-12)10-7(3)8(4)15-9(10)5/h6H,12H2,1-5H3,(H,13,14) |
| InChIKey | OFIZYNUVJMDFKG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|