C8H9N3OS — CID 43164224
5-(2,5-dimethylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 43164224) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-(2,5-dimethylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,5-dimethylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 43164224 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5-(2,5-dimethylfuran-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1cc(-c2nc(=S)[nH][nH]2)c(C)o1 |
| InChI | InChI=1S/C8H9N3OS/c1-4-3-6(5(2)12-4)7-9-8(13)11-10-7/h3H,1-2H3,(H2,9,10,11,13) |
| InChIKey | BMFIRMHWHXYFRP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|