C8H13N3O — CID 61360852
N-amino-N',2,5-trimethylfuran-3-carboximidamide (PubChem CID 61360852) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is N-amino-N',2,5-trimethylfuran-3-carboximidamide.
| Compound Name | N-amino-N',2,5-trimethylfuran-3-carboximidamide |
|---|---|
| PubChem CID | 61360852 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-amino-N',2,5-trimethylfuran-3-carboximidamide |
| SMILES | C/N=C(\NN)c1cc(C)oc1C |
| InChI | InChI=1S/C8H13N3O/c1-5-4-7(6(2)12-5)8(10-3)11-9/h4H,9H2,1-3H3,(H,10,11) |
| InChIKey | OJIFQXQAMBAZIS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|