C16H19NO4 — CID 65155065
6-(2,4,5-trimethyloxolane-3-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 65155065) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 6-(2,4,5-trimethyloxolane-3-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,4,5-trimethyloxolane-3-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 65155065 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 6-(2,4,5-trimethyloxolane-3-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC1OC(C)C(C(=O)c2ccc3c(c2)NC(=O)CO3)C1C |
| InChI | InChI=1S/C16H19NO4/c1-8-9(2)21-10(3)15(8)16(19)11-4-5-13-12(6-11)17-14(18)7-20-13/h4-6,8-10,15H,7H2,1-3H3,(H,17,18) |
| InChIKey | SUZXVXGXHXUYGC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |