C13H14BrNO4 — CID 65156898
3-bromo-2-[[2-(oxolan-2-yl)acetyl]amino]benzoic acid (PubChem CID 65156898) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-bromo-2-[[2-(oxolan-2-yl)acetyl]amino]benzoic acid.
| Compound Name | 3-bromo-2-[[2-(oxolan-2-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 65156898 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-bromo-2-[[2-(oxolan-2-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(CC1CCCO1)Nc1c(Br)cccc1C(=O)O |
| InChI | InChI=1S/C13H14BrNO4/c14-10-5-1-4-9(13(17)18)12(10)15-11(16)7-8-3-2-6-19-8/h1,4-5,8H,2-3,6-7H2,(H,15,16)(H,17,18) |
| InChIKey | MCNDIUSHJPCQJF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |