C13H22N4O — CID 65159846
8-methyl-3-(2,4,5-trimethyloxolan-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 65159846) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 8-methyl-3-(2,4,5-trimethyloxolan-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-methyl-3-(2,4,5-trimethyloxolan-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 65159846 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 8-methyl-3-(2,4,5-trimethyloxolan-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CC1NCCn2c1nnc2C1C(C)OC(C)C1C |
| InChI | InChI=1S/C13H22N4O/c1-7-9(3)18-10(4)11(7)13-16-15-12-8(2)14-5-6-17(12)13/h7-11,14H,5-6H2,1-4H3 |
| InChIKey | CTRXMQZSPCNOFN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |