About 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate
3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate (PubChem CID 65166038) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate.
Molecular Properties
| Compound Name | 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate |
| PubChem CID | 65166038 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate |
| SMILES | Nc1ccccc1OCC(=O)OCCCC1CCCO1 |
| InChI | InChI=1S/C15H21NO4/c16-13-7-1-2-8-14(13)20-11-15(17)19-10-4-6-12-5-3-9-18-12/h1-2,7-8,12H,3-6,9-11,16H2 |
| InChIKey | PKEDZRNGCQTCQK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate?
The IUPAC name of 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate (CID 65166038) is 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate.
What is the SMILES notation for 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate?
The canonical SMILES for 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate is Nc1ccccc1OCC(=O)OCCCC1CCCO1.
What is the InChIKey of 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate?
The InChIKey is PKEDZRNGCQTCQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c16-13-7-1-2-8-14(13)20-11-15(17)19-10-4-6-12-5-3-9-18-12/h1-2,7-8,12H,3-6,9-11,16H2.
What are the key properties of 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate?
3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate has a molecular weight of 279.34 g/mol, XLogP of 2.15, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-2-yl)propyl 2-(2-aminophenoxy)acetate is sourced from PubChem (CID 65166038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).