C12H16O4 — CID 97078806
2-[(2R)-oxolan-2-yl]ethyl 2-(furan-2-yl)acetate (PubChem CID 97078806) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(2R)-oxolan-2-yl]ethyl 2-(furan-2-yl)acetate.
| Compound Name | 2-[(2R)-oxolan-2-yl]ethyl 2-(furan-2-yl)acetate |
|---|---|
| PubChem CID | 97078806 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[(2R)-oxolan-2-yl]ethyl 2-(furan-2-yl)acetate |
| SMILES | O=C(Cc1ccco1)OCC[C@H]1CCCO1 |
| InChI | InChI=1S/C12H16O4/c13-12(9-11-4-2-7-15-11)16-8-5-10-3-1-6-14-10/h2,4,7,10H,1,3,5-6,8-9H2/t10-/m1/s1 |
| InChIKey | XMBDGDUDAWJNTF-SNVBAGLBSA-N |
| XLogP | 1.93 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |