C11H12N2OS — CID 65168617
2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]aniline (PubChem CID 65168617) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]aniline.
| Compound Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]aniline |
|---|---|
| PubChem CID | 65168617 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]aniline |
| SMILES | Cc1nc(Oc2ccccc2N)sc1C |
| InChI | InChI=1S/C11H12N2OS/c1-7-8(2)15-11(13-7)14-10-6-4-3-5-9(10)12/h3-6H,12H2,1-2H3 |
| InChIKey | QTZUHQCPNGBBOW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|