C11H11FN2OS — CID 65168674
2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]-4-fluoroaniline (PubChem CID 65168674) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]-4-fluoroaniline.
| Compound Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]-4-fluoroaniline |
|---|---|
| PubChem CID | 65168674 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)oxy]-4-fluoroaniline |
| SMILES | Cc1nc(Oc2cc(F)ccc2N)sc1C |
| InChI | InChI=1S/C11H11FN2OS/c1-6-7(2)16-11(14-6)15-10-5-8(12)3-4-9(10)13/h3-5H,13H2,1-2H3 |
| InChIKey | JOHDNDZYGHVPNH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|