C15H17BrO — CID 65176853
3-[(2-bromophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 65176853) has the molecular formula C15H17BrO and a molecular weight of 293.20 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(2-bromophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 65176853 |
| Molecular Formula | C15H17BrO |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-[(2-bromophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(Cc2ccccc2Br)C1 |
| InChI | InChI=1S/C15H17BrO/c1-15(2)9-11(8-13(17)10-15)7-12-5-3-4-6-14(12)16/h3-6,8H,7,9-10H2,1-2H3 |
| InChIKey | XBGSAWGISOBZCC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |