C17H22O2 — CID 65177399
5,5-dimethyl-3-(4-propan-2-yloxyphenyl)cyclohex-2-en-1-one (PubChem CID 65177399) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-propan-2-yloxyphenyl)cyclohex-2-en-1-one.
| Compound Name | 5,5-dimethyl-3-(4-propan-2-yloxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 65177399 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 5,5-dimethyl-3-(4-propan-2-yloxyphenyl)cyclohex-2-en-1-one |
| SMILES | CC(C)Oc1ccc(C2=CC(=O)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H22O2/c1-12(2)19-16-7-5-13(6-8-16)14-9-15(18)11-17(3,4)10-14/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | LYVBDDQZMYDQHI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |