C14H27N — CID 65177413
5,5-dimethyl-3-(2-methylpentyl)cyclohex-2-en-1-amine (PubChem CID 65177413) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 5,5-dimethyl-3-(2-methylpentyl)cyclohex-2-en-1-amine.
| Compound Name | 5,5-dimethyl-3-(2-methylpentyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 65177413 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 5,5-dimethyl-3-(2-methylpentyl)cyclohex-2-en-1-amine |
| SMILES | CCCC(C)CC1=CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C14H27N/c1-5-6-11(2)7-12-8-13(15)10-14(3,4)9-12/h8,11,13H,5-7,9-10,15H2,1-4H3 |
| InChIKey | JSNFCIAOGJOGNF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|