C14H21NS — CID 65177525
5,5-dimethyl-3-(2-thiophen-3-ylethyl)cyclohex-2-en-1-amine (PubChem CID 65177525) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 5,5-dimethyl-3-(2-thiophen-3-ylethyl)cyclohex-2-en-1-amine.
| Compound Name | 5,5-dimethyl-3-(2-thiophen-3-ylethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 65177525 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 5,5-dimethyl-3-(2-thiophen-3-ylethyl)cyclohex-2-en-1-amine |
| SMILES | CC1(C)CC(CCc2ccsc2)=CC(N)C1 |
| InChI | InChI=1S/C14H21NS/c1-14(2)8-12(7-13(15)9-14)4-3-11-5-6-16-10-11/h5-7,10,13H,3-4,8-9,15H2,1-2H3 |
| InChIKey | RUEMEZWPQFKRHA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|