C10H12N2O2 — CID 65179075
2-[5-(2-methylfuran-3-yl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65179075) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-[5-(2-methylfuran-3-yl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2-methylfuran-3-yl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65179075 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-[5-(2-methylfuran-3-yl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | Cc1occc1-c1cnc(CCN)o1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-8(3-5-13-7)9-6-12-10(14-9)2-4-11/h3,5-6H,2,4,11H2,1H3 |
| InChIKey | BQSUOMFFPHKCEJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |