C8H12ClNO2 — CID 65179822
2-(2-chloroethyl)-5-(ethoxymethyl)-1,3-oxazole (PubChem CID 65179822) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(ethoxymethyl)-1,3-oxazole.
| Compound Name | 2-(2-chloroethyl)-5-(ethoxymethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 65179822 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-(2-chloroethyl)-5-(ethoxymethyl)-1,3-oxazole |
| SMILES | CCOCc1cnc(CCCl)o1 |
| InChI | InChI=1S/C8H12ClNO2/c1-2-11-6-7-5-10-8(12-7)3-4-9/h5H,2-4,6H2,1H3 |
| InChIKey | INNCTLPUQKWIGS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|