C14H24N2O3 — CID 65181971
2-methoxy-N-[[5-(2,4,5-trimethyloxolan-3-yl)-1,3-oxazol-2-yl]methyl]ethanamine (PubChem CID 65181971) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-methoxy-N-[[5-(2,4,5-trimethyloxolan-3-yl)-1,3-oxazol-2-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[5-(2,4,5-trimethyloxolan-3-yl)-1,3-oxazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 65181971 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-methoxy-N-[[5-(2,4,5-trimethyloxolan-3-yl)-1,3-oxazol-2-yl]methyl]ethanamine |
| SMILES | COCCNCc1ncc(C2C(C)OC(C)C2C)o1 |
| InChI | InChI=1S/C14H24N2O3/c1-9-10(2)18-11(3)14(9)12-7-16-13(19-12)8-15-5-6-17-4/h7,9-11,14-15H,5-6,8H2,1-4H3 |
| InChIKey | RAOWOUZHMVQBSJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|