C9H13BrN2OS — CID 65193512
N-(1-aminobutan-2-yl)-3-bromothiophene-2-carboxamide (PubChem CID 65193512) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-3-bromothiophene-2-carboxamide.
| Compound Name | N-(1-aminobutan-2-yl)-3-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 65193512 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | N-(1-aminobutan-2-yl)-3-bromothiophene-2-carboxamide |
| SMILES | CCC(CN)NC(=O)c1sccc1Br |
| InChI | InChI=1S/C9H13BrN2OS/c1-2-6(5-11)12-9(13)8-7(10)3-4-14-8/h3-4,6H,2,5,11H2,1H3,(H,12,13) |
| InChIKey | GGMQJNNTSHQXQL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |