C12H18BrNOS — CID 97053966
3-bromo-N-[(2S,4R)-4-methylhexan-2-yl]thiophene-2-carboxamide (PubChem CID 97053966) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is 3-bromo-N-[(2S,4R)-4-methylhexan-2-yl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[(2S,4R)-4-methylhexan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97053966 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-bromo-N-[(2S,4R)-4-methylhexan-2-yl]thiophene-2-carboxamide |
| SMILES | CC[C@@H](C)C[C@H](C)NC(=O)c1sccc1Br |
| InChI | InChI=1S/C12H18BrNOS/c1-4-8(2)7-9(3)14-12(15)11-10(13)5-6-16-11/h5-6,8-9H,4,7H2,1-3H3,(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | BPQHKMWNERHHIA-BDAKNGLRSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |