C12H18N4O2S — CID 65210017
4-tert-butyl-N-(6-oxopiperidin-3-yl)thiadiazole-5-carboxamide (PubChem CID 65210017) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-tert-butyl-N-(6-oxopiperidin-3-yl)thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-(6-oxopiperidin-3-yl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65210017 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-tert-butyl-N-(6-oxopiperidin-3-yl)thiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C12H18N4O2S/c1-12(2,3)10-9(19-16-15-10)11(18)14-7-4-5-8(17)13-6-7/h7H,4-6H2,1-3H3,(H,13,17)(H,14,18) |
| InChIKey | FFTJMKYJKJDGRG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |