C12H20N4OS — CID 65210533
(4-tert-butylthiadiazol-5-yl)-(2-methylpiperazin-1-yl)methanone (PubChem CID 65210533) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is (4-tert-butylthiadiazol-5-yl)-(2-methylpiperazin-1-yl)methanone.
| Compound Name | (4-tert-butylthiadiazol-5-yl)-(2-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 65210533 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (4-tert-butylthiadiazol-5-yl)-(2-methylpiperazin-1-yl)methanone |
| SMILES | CC1CNCCN1C(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C12H20N4OS/c1-8-7-13-5-6-16(8)11(17)9-10(12(2,3)4)14-15-18-9/h8,13H,5-7H2,1-4H3 |
| InChIKey | AAFWDIGNZMWCDG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |