C12H16O4S — CID 65213841
3-[(1-hydroxycyclopentyl)methoxy]-5-methylthiophene-2-carboxylic acid (PubChem CID 65213841) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-[(1-hydroxycyclopentyl)methoxy]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(1-hydroxycyclopentyl)methoxy]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 65213841 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[(1-hydroxycyclopentyl)methoxy]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(OCC2(O)CCCC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C12H16O4S/c1-8-6-9(10(17-8)11(13)14)16-7-12(15)4-2-3-5-12/h6,15H,2-5,7H2,1H3,(H,13,14) |
| InChIKey | NTTIMTVMBRLTDV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |