C13H11N3O2S — CID 65215157
N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiadiazole-5-carboxamide (PubChem CID 65215157) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiadiazole-5-carboxamide.
| Compound Name | N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65215157 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]thiadiazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1C#CCO)c1cnns1 |
| InChI | InChI=1S/C13H11N3O2S/c17-7-3-6-10-4-1-2-5-11(10)8-14-13(18)12-9-15-16-19-12/h1-2,4-5,9,17H,7-8H2,(H,14,18) |
| InChIKey | OCBNXENLSRNXGW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|