2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid

C6H4N4O3S2 — CID 65216105

IUPAC2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid
SMILESO=C(O)CSc1nnc(-c2csnn2)o1
InChIInChI=1S/C6H4N4O3S2/c11-4(12)2-14-6-9-8-5(13-6)3-1-15-10-7-3/h1H,2H2,(H,11,12)
InChIKeyCEJFDOHKZRRTNK-UHFFFAOYSA-N
MW244.26 g/mol
LogP0.76
Rot. Bonds4

About 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid

2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 65216105) has the molecular formula C6H4N4O3S2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.

Molecular Properties

Compound Name2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid
PubChem CID65216105
Molecular FormulaC6H4N4O3S2
Molecular Weight244.26 g/mol
Exact Mass243.97
IUPAC Name2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid
SMILESO=C(O)CSc1nnc(-c2csnn2)o1
InChIInChI=1S/C6H4N4O3S2/c11-4(12)2-14-6-9-8-5(13-6)3-1-15-10-7-3/h1H,2H2,(H,11,12)
InChIKeyCEJFDOHKZRRTNK-UHFFFAOYSA-N
XLogP0.76
TPSA102.00 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.26
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Analyze 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
The IUPAC name of 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (CID 65216105) is 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
What is the SMILES notation for 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
The canonical SMILES for 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid is O=C(O)CSc1nnc(-c2csnn2)o1.
What is the InChIKey of 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
The InChIKey is CEJFDOHKZRRTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O3S2/c11-4(12)2-14-6-9-8-5(13-6)3-1-15-10-7-3/h1H,2H2,(H,11,12).
What are the key properties of 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid?
2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid has a molecular weight of 244.26 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(thiadiazol-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid is sourced from PubChem (CID 65216105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).