C13H21NO3 — CID 65234980
3-(3,4-dimethoxyphenyl)-3-(methylamino)butan-1-ol (PubChem CID 65234980) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-(methylamino)butan-1-ol.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 65234980 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-(methylamino)butan-1-ol |
| SMILES | CNC(C)(CCO)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H21NO3/c1-13(14-2,7-8-15)10-5-6-11(16-3)12(9-10)17-4/h5-6,9,14-15H,7-8H2,1-4H3 |
| InChIKey | AAAMBLZAKIYLSL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |