C9H7ClN2O — CID 65240203
4-(chloromethyl)-5-pyridin-3-yl-1,2-oxazole (PubChem CID 65240203) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 4-(chloromethyl)-5-pyridin-3-yl-1,2-oxazole.
| Compound Name | 4-(chloromethyl)-5-pyridin-3-yl-1,2-oxazole |
|---|---|
| PubChem CID | 65240203 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 4-(chloromethyl)-5-pyridin-3-yl-1,2-oxazole |
| SMILES | ClCc1cnoc1-c1cccnc1 |
| InChI | InChI=1S/C9H7ClN2O/c10-4-8-6-12-13-9(8)7-2-1-3-11-5-7/h1-3,5-6H,4H2 |
| InChIKey | FNFCDIOMWYSHRX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|