C11H14Cl2N2 — CID 65244974
1-[1-(2,5-dichlorophenyl)ethyl]azetidin-3-amine (PubChem CID 65244974) has the molecular formula C11H14Cl2N2 and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-[1-(2,5-dichlorophenyl)ethyl]azetidin-3-amine.
| Compound Name | 1-[1-(2,5-dichlorophenyl)ethyl]azetidin-3-amine |
|---|---|
| PubChem CID | 65244974 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-[1-(2,5-dichlorophenyl)ethyl]azetidin-3-amine |
| SMILES | CC(c1cc(Cl)ccc1Cl)N1CC(N)C1 |
| InChI | InChI=1S/C11H14Cl2N2/c1-7(15-5-9(14)6-15)10-4-8(12)2-3-11(10)13/h2-4,7,9H,5-6,14H2,1H3 |
| InChIKey | JNZOGZGDMKYJQO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |