C14H19Cl2FN2 — CID 79993227
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpiperidin-3-amine (PubChem CID 79993227) has the molecular formula C14H19Cl2FN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpiperidin-3-amine.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 79993227 |
| Molecular Formula | C14H19Cl2FN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpiperidin-3-amine |
| SMILES | CC1CC(N)CN(C(C)c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H19Cl2FN2/c1-8-3-10(18)7-19(6-8)9(2)11-4-14(17)13(16)5-12(11)15/h4-5,8-10H,3,6-7,18H2,1-2H3 |
| InChIKey | XMCQDBFYWYYNIN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|