C16H24ClN3S — CID 65247125
4-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethylbutanethioamide (PubChem CID 65247125) has the molecular formula C16H24ClN3S and a molecular weight of 325.91 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethylbutanethioamide.
| Compound Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65247125 |
| Molecular Formula | C16H24ClN3S |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCN1CCN(c2cccc(Cl)c2)CC1)C(N)=S |
| InChI | InChI=1S/C16H24ClN3S/c1-16(2,15(18)21)6-7-19-8-10-20(11-9-19)14-5-3-4-13(17)12-14/h3-5,12H,6-11H2,1-2H3,(H2,18,21) |
| InChIKey | ITYCMVQFAOQVEL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|