C15H28N2S — CID 65247296
4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-dimethylbutanethioamide (PubChem CID 65247296) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-dimethylbutanethioamide.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65247296 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCN1CCCC2CCCCC21)C(N)=S |
| InChI | InChI=1S/C15H28N2S/c1-15(2,14(16)18)9-11-17-10-5-7-12-6-3-4-8-13(12)17/h12-13H,3-11H2,1-2H3,(H2,16,18) |
| InChIKey | YTNRXGBVIVUJCV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|