C12H23N3OS — CID 65249374
1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)piperidine-2-carboxamide (PubChem CID 65249374) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)piperidine-2-carboxamide.
| Compound Name | 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 65249374 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)piperidine-2-carboxamide |
| SMILES | CC(C)(CCN1CCCCC1C(N)=O)C(N)=S |
| InChI | InChI=1S/C12H23N3OS/c1-12(2,11(14)17)6-8-15-7-4-3-5-9(15)10(13)16/h9H,3-8H2,1-2H3,(H2,13,16)(H2,14,17) |
| InChIKey | FGYFLJPNBVCXCE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|