C13H19N3 — CID 65247657
2,2-dimethyl-4-[(6-methyl-3-pyridinyl)methylamino]butanenitrile (PubChem CID 65247657) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(6-methyl-3-pyridinyl)methylamino]butanenitrile.
| Compound Name | 2,2-dimethyl-4-[(6-methyl-3-pyridinyl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 65247657 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2,2-dimethyl-4-[(6-methyl-3-pyridinyl)methylamino]butanenitrile |
| SMILES | Cc1ccc(CNCCC(C)(C)C#N)cn1 |
| InChI | InChI=1S/C13H19N3/c1-11-4-5-12(9-16-11)8-15-7-6-13(2,3)10-14/h4-5,9,15H,6-8H2,1-3H3 |
| InChIKey | XCIPUCSOLMUVKE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|